C16H23F6NaO9S — CID 46222188
sodium 1,4-dioxo-1,4-bis[5-(trifluoromethoxy)pentoxy]butane-2-sulfonate (PubChem CID 46222188) has the molecular formula C16H23F6NaO9S and a molecular weight of 528.40 g/mol. Its IUPAC name is sodium 1,4-dioxo-1,4-bis[5-(trifluoromethoxy)pentoxy]butane-2-sulfonate.
| Compound Name | sodium 1,4-dioxo-1,4-bis[5-(trifluoromethoxy)pentoxy]butane-2-sulfonate |
|---|---|
| PubChem CID | 46222188 |
| Molecular Formula | C16H23F6NaO9S |
| Molecular Weight | 528.40 g/mol |
| Exact Mass | 528.09 |
| IUPAC Name | sodium 1,4-dioxo-1,4-bis[5-(trifluoromethoxy)pentoxy]butane-2-sulfonate |
| SMILES | O=C(CC(C(=O)OCCCCCOC(F)(F)F)S(=O)(=O)[O-])OCCCCCOC(F)(F)F.[Na+] |
| InChI | InChI=1S/C16H24F6O9S.Na/c17-15(18,19)30-9-5-1-3-7-28-13(23)11-12(32(25,26)27)14(24)29-8-4-2-6-10-31-16(20,21)22;/h12H,1-11H2,(H,25,26,27);/q;+1/p-1 |
| InChIKey | JCSIFGXHWWPHPA-UHFFFAOYSA-M |
| XLogP | -0.21 |
| TPSA | 128.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.40 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|