C20H41NaO7SSi — CID 173418135
sodium;1,4-dioctoxy-1,4-dioxobutane-2-sulfonate;silane (PubChem CID 173418135) has the molecular formula C20H41NaO7SSi and a molecular weight of 476.68 g/mol. Its IUPAC name is sodium;1,4-dioctoxy-1,4-dioxobutane-2-sulfonate;silane.
| Compound Name | sodium;1,4-dioctoxy-1,4-dioxobutane-2-sulfonate;silane |
|---|---|
| PubChem CID | 173418135 |
| Molecular Formula | C20H41NaO7SSi |
| Molecular Weight | 476.68 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | sodium;1,4-dioctoxy-1,4-dioxobutane-2-sulfonate;silane |
| SMILES | CCCCCCCCOC(=O)CC(C(=O)OCCCCCCCC)S(=O)(=O)[O-].[Na+].[SiH4] |
| InChI | InChI=1S/C20H38O7S.Na.H4Si/c1-3-5-7-9-11-13-15-26-19(21)17-18(28(23,24)25)20(22)27-16-14-12-10-8-6-4-2;;/h18H,3-17H2,1-2H3,(H,23,24,25);;1H4/q;+1;/p-1 |
| InChIKey | WVWUPCFLIWXTPP-UHFFFAOYSA-M |
| XLogP | -0.35 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.68 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|