C18H37NO7S — CID 172862876
azane;1,4-diheptoxy-1,4-dioxobutane-2-sulfonic acid (PubChem CID 172862876) has the molecular formula C18H37NO7S and a molecular weight of 411.56 g/mol. Its IUPAC name is azane;1,4-diheptoxy-1,4-dioxobutane-2-sulfonic acid.
| Compound Name | azane;1,4-diheptoxy-1,4-dioxobutane-2-sulfonic acid |
|---|---|
| PubChem CID | 172862876 |
| Molecular Formula | C18H37NO7S |
| Molecular Weight | 411.56 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | azane;1,4-diheptoxy-1,4-dioxobutane-2-sulfonic acid |
| SMILES | CCCCCCCOC(=O)CC(C(=O)OCCCCCCC)S(=O)(=O)O.N |
| InChI | InChI=1S/C18H34O7S.H3N/c1-3-5-7-9-11-13-24-17(19)15-16(26(21,22)23)18(20)25-14-12-10-8-6-4-2;/h16H,3-15H2,1-2H3,(H,21,22,23);1H3 |
| InChIKey | ZPAWQJQIEFEGPN-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 141.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.56 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|