C40H74NaO7S — CID 158735342
CID 158735342 (PubChem CID 158735342) has the molecular formula C40H74NaO7S and a molecular weight of 722.08 g/mol.
| Compound Name | CID 158735342 |
|---|---|
| PubChem CID | 158735342 |
| Molecular Formula | C40H74NaO7S |
| Molecular Weight | 722.08 g/mol |
| Exact Mass | 721.51 |
| IUPAC Name | — |
| SMILES | CCCCCCCCC=CCCCCCCCCOC(=O)CC(C(=O)OCCCCCCCCC=CCCCCCCCC)S(=O)(=O)O.[Na] |
| InChI | InChI=1S/C40H74O7S.Na/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-46-39(41)37-38(48(43,44)45)40(42)47-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2;/h17-20,38H,3-16,21-37H2,1-2H3,(H,43,44,45); |
| InChIKey | ILPKZHSZYJGVNL-UHFFFAOYSA-N |
| XLogP | 11.41 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.08 |
| LogP ≤ 5 | 11.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|