C36H68O5S — CID 57317212
1-octadec-9-enoxy-1-oxooctadec-9-ene-2-sulfonic acid (PubChem CID 57317212) has the molecular formula C36H68O5S and a molecular weight of 613.00 g/mol. Its IUPAC name is 1-octadec-9-enoxy-1-oxooctadec-9-ene-2-sulfonic acid.
| Compound Name | 1-octadec-9-enoxy-1-oxooctadec-9-ene-2-sulfonic acid |
|---|---|
| PubChem CID | 57317212 |
| Molecular Formula | C36H68O5S |
| Molecular Weight | 613.00 g/mol |
| Exact Mass | 612.48 |
| IUPAC Name | 1-octadec-9-enoxy-1-oxooctadec-9-ene-2-sulfonic acid |
| SMILES | CCCCCCCCC=CCCCCCCCCOC(=O)C(CCCCCCC=CCCCCCCCC)S(=O)(=O)O |
| InChI | InChI=1S/C36H68O5S/c1-3-5-7-9-11-13-15-17-19-20-22-24-26-28-30-32-34-41-36(37)35(42(38,39)40)33-31-29-27-25-23-21-18-16-14-12-10-8-6-4-2/h17-19,21,35H,3-16,20,22-34H2,1-2H3,(H,38,39,40) |
| InChIKey | YWGLSSWJTWBXQF-UHFFFAOYSA-N |
| XLogP | 11.47 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.00 |
| LogP ≤ 5 | 11.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|