C19H36O6S — CID 132608635
(Z)-12-hydroxy-1-methoxy-1-oxooctadec-9-ene-2-sulfonic acid (PubChem CID 132608635) has the molecular formula C19H36O6S and a molecular weight of 392.56 g/mol. Its IUPAC name is (Z)-12-hydroxy-1-methoxy-1-oxooctadec-9-ene-2-sulfonic acid.
| Compound Name | (Z)-12-hydroxy-1-methoxy-1-oxooctadec-9-ene-2-sulfonic acid |
|---|---|
| PubChem CID | 132608635 |
| Molecular Formula | C19H36O6S |
| Molecular Weight | 392.56 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | (Z)-12-hydroxy-1-methoxy-1-oxooctadec-9-ene-2-sulfonic acid |
| SMILES | CCCCCCC(O)C/C=C\CCCCCCC(C(=O)OC)S(=O)(=O)O |
| InChI | InChI=1S/C19H36O6S/c1-3-4-5-11-14-17(20)15-12-9-7-6-8-10-13-16-18(19(21)25-2)26(22,23)24/h9,12,17-18,20H,3-8,10-11,13-16H2,1-2H3,(H,22,23,24)/b12-9- |
| InChIKey | GUUFNWWGBMVQPW-XFXZXTDPSA-N |
| XLogP | 4.03 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.56 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|