C12H22NaO7S+ — CID 18538186
sodium 1,4-dibutoxy-1,4-dioxobutane-2-sulfonic acid (PubChem CID 18538186) has the molecular formula C12H22NaO7S+ and a molecular weight of 333.36 g/mol. Its IUPAC name is sodium 1,4-dibutoxy-1,4-dioxobutane-2-sulfonic acid.
| Compound Name | sodium 1,4-dibutoxy-1,4-dioxobutane-2-sulfonic acid |
|---|---|
| PubChem CID | 18538186 |
| Molecular Formula | C12H22NaO7S+ |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | sodium 1,4-dibutoxy-1,4-dioxobutane-2-sulfonic acid |
| SMILES | CCCCOC(=O)CC(C(=O)OCCCC)S(=O)(=O)O.[Na+] |
| InChI | InChI=1S/C12H22O7S.Na/c1-3-5-7-18-11(13)9-10(20(15,16)17)12(14)19-8-6-4-2;/h10H,3-9H2,1-2H3,(H,15,16,17);/q;+1 |
| InChIKey | JLABKOUORPVZCA-UHFFFAOYSA-N |
| XLogP | -1.68 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|