C36H68O20S2 — CID 160545561
1,4-bis(2-butoxyethoxy)-1,4-dioxobutane-2-sulfonic acid;1,4-bis[2-(2-butoxyethoxy)ethoxy]-1,4-dioxobutane-2-sulfonic acid (PubChem CID 160545561) has the molecular formula C36H68O20S2 and a molecular weight of 885.05 g/mol. Its IUPAC name is 1,4-bis(2-butoxyethoxy)-1,4-dioxobutane-2-sulfonic acid;1,4-bis[2-(2-butoxyethoxy)ethoxy]-1,4-dioxobutane-2-sulfonic acid.
| Compound Name | 1,4-bis(2-butoxyethoxy)-1,4-dioxobutane-2-sulfonic acid;1,4-bis[2-(2-butoxyethoxy)ethoxy]-1,4-dioxobutane-2-sulfonic acid |
|---|---|
| PubChem CID | 160545561 |
| Molecular Formula | C36H68O20S2 |
| Molecular Weight | 885.05 g/mol |
| Exact Mass | 884.37 |
| IUPAC Name | 1,4-bis(2-butoxyethoxy)-1,4-dioxobutane-2-sulfonic acid;1,4-bis[2-(2-butoxyethoxy)ethoxy]-1,4-dioxobutane-2-sulfonic acid |
| SMILES | CCCCOCCOC(=O)CC(C(=O)OCCOCCCC)S(=O)(=O)O.CCCCOCCOCCOC(=O)CC(C(=O)OCCOCCOCCCC)S(=O)(=O)O |
| InChI | InChI=1S/C20H38O11S.C16H30O9S/c1-3-5-7-26-9-11-28-13-15-30-19(21)17-18(32(23,24)25)20(22)31-16-14-29-12-10-27-8-6-4-2;1-3-5-7-22-9-11-24-15(17)13-14(26(19,20)21)16(18)25-12-10-23-8-6-4-2/h18H,3-17H2,1-2H3,(H,23,24,25);14H,3-13H2,1-2H3,(H,19,20,21) |
| InChIKey | QXJOLOINJLPJOA-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 269.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 885.05 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|