C16H29KO7S — CID 58122610
potassium 1,4-dihexoxy-1,4-dioxobutane-2-sulfonate (PubChem CID 58122610) has the molecular formula C16H29KO7S and a molecular weight of 404.57 g/mol. Its IUPAC name is potassium 1,4-dihexoxy-1,4-dioxobutane-2-sulfonate.
| Compound Name | potassium 1,4-dihexoxy-1,4-dioxobutane-2-sulfonate |
|---|---|
| PubChem CID | 58122610 |
| Molecular Formula | C16H29KO7S |
| Molecular Weight | 404.57 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | potassium 1,4-dihexoxy-1,4-dioxobutane-2-sulfonate |
| SMILES | CCCCCCOC(=O)CC(C(=O)OCCCCCC)S(=O)(=O)[O-].[K+] |
| InChI | InChI=1S/C16H30O7S.K/c1-3-5-7-9-11-22-15(17)13-14(24(19,20)21)16(18)23-12-10-8-6-4-2;/h14H,3-13H2,1-2H3,(H,19,20,21);/q;+1/p-1 |
| InChIKey | RHNSLDDWADBTHE-UHFFFAOYSA-M |
| XLogP | -0.46 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.57 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|