C22H45NO7S — CID 159705596
azanium 1,4-bis(7-methyloctoxy)-1,4-dioxobutane-2-sulfonate (PubChem CID 159705596) has the molecular formula C22H45NO7S and a molecular weight of 467.67 g/mol. Its IUPAC name is azanium 1,4-bis(7-methyloctoxy)-1,4-dioxobutane-2-sulfonate.
| Compound Name | azanium 1,4-bis(7-methyloctoxy)-1,4-dioxobutane-2-sulfonate |
|---|---|
| PubChem CID | 159705596 |
| Molecular Formula | C22H45NO7S |
| Molecular Weight | 467.67 g/mol |
| Exact Mass | 467.29 |
| IUPAC Name | azanium 1,4-bis(7-methyloctoxy)-1,4-dioxobutane-2-sulfonate |
| SMILES | CC(C)CCCCCCOC(=O)CC(C(=O)OCCCCCCC(C)C)S(=O)(=O)[O-].[NH4+] |
| InChI | InChI=1S/C22H42O7S.H3N/c1-18(2)13-9-5-7-11-15-28-21(23)17-20(30(25,26)27)22(24)29-16-12-8-6-10-14-19(3)4;/h18-20H,5-17H2,1-4H3,(H,25,26,27);1H3 |
| InChIKey | GPDDSCWJNFDDII-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 146.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.67 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|