C14H24Na2O7S — CID 15748521
disodium;4-(8-methylnonoxy)-4-oxo-2-sulfonatobutanoate (PubChem CID 15748521) has the molecular formula C14H24Na2O7S and a molecular weight of 382.39 g/mol. Its IUPAC name is disodium;4-(8-methylnonoxy)-4-oxo-2-sulfonatobutanoate.
| Compound Name | disodium;4-(8-methylnonoxy)-4-oxo-2-sulfonatobutanoate |
|---|---|
| PubChem CID | 15748521 |
| Molecular Formula | C14H24Na2O7S |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | disodium;4-(8-methylnonoxy)-4-oxo-2-sulfonatobutanoate |
| SMILES | CC(C)CCCCCCCOC(=O)CC(C(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C14H26O7S.2Na/c1-11(2)8-6-4-3-5-7-9-21-13(15)10-12(14(16)17)22(18,19)20;;/h11-12H,3-10H2,1-2H3,(H,16,17)(H,18,19,20);;/q;2*+1/p-2 |
| InChIKey | XGWOIOIVSZIIKJ-UHFFFAOYSA-L |
| XLogP | -5.41 |
| TPSA | 123.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | -5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|