C20H38NaO7S — CID 158742503
CID 158742503 (PubChem CID 158742503) has the molecular formula C20H38NaO7S and a molecular weight of 445.57 g/mol.
| Compound Name | CID 158742503 |
|---|---|
| PubChem CID | 158742503 |
| Molecular Formula | C20H38NaO7S |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | — |
| SMILES | CC(C)CCCCCOC(=O)CC(C(=O)OCCCCCC(C)C)S(=O)(=O)O.[Na] |
| InChI | InChI=1S/C20H38O7S.Na/c1-16(2)11-7-5-9-13-26-19(21)15-18(28(23,24)25)20(22)27-14-10-6-8-12-17(3)4;/h16-18H,5-15H2,1-4H3,(H,23,24,25); |
| InChIKey | IMLXCKIOFHIZJR-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|