C16H33NaO7SSi2 — CID 132607077
sodium 1,4-dioxo-1,4-bis(3-trimethylsilylpropoxy)butane-2-sulfonate (PubChem CID 132607077) has the molecular formula C16H33NaO7SSi2 and a molecular weight of 448.66 g/mol. Its IUPAC name is sodium 1,4-dioxo-1,4-bis(3-trimethylsilylpropoxy)butane-2-sulfonate.
| Compound Name | sodium 1,4-dioxo-1,4-bis(3-trimethylsilylpropoxy)butane-2-sulfonate |
|---|---|
| PubChem CID | 132607077 |
| Molecular Formula | C16H33NaO7SSi2 |
| Molecular Weight | 448.66 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | sodium 1,4-dioxo-1,4-bis(3-trimethylsilylpropoxy)butane-2-sulfonate |
| SMILES | C[Si](C)(C)CCCOC(=O)CC(C(=O)OCCC[Si](C)(C)C)S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C16H34O7SSi2.Na/c1-25(2,3)11-7-9-22-15(17)13-14(24(19,20)21)16(18)23-10-8-12-26(4,5)6;/h14H,7-13H2,1-6H3,(H,19,20,21);/q;+1/p-1 |
| InChIKey | ZDUNBIGSKZBXTJ-UHFFFAOYSA-M |
| XLogP | -0.16 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.66 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|