C42H43N2NaO9S — CID 101440044
sodium 1,4-bis[6-[4-(4-cyanophenyl)phenoxy]hexoxy]-1,4-dioxobutane-2-sulfonate (PubChem CID 101440044) has the molecular formula C42H43N2NaO9S and a molecular weight of 774.87 g/mol. Its IUPAC name is sodium 1,4-bis[6-[4-(4-cyanophenyl)phenoxy]hexoxy]-1,4-dioxobutane-2-sulfonate.
| Compound Name | sodium 1,4-bis[6-[4-(4-cyanophenyl)phenoxy]hexoxy]-1,4-dioxobutane-2-sulfonate |
|---|---|
| PubChem CID | 101440044 |
| Molecular Formula | C42H43N2NaO9S |
| Molecular Weight | 774.87 g/mol |
| Exact Mass | 774.26 |
| IUPAC Name | sodium 1,4-bis[6-[4-(4-cyanophenyl)phenoxy]hexoxy]-1,4-dioxobutane-2-sulfonate |
| SMILES | N#Cc1ccc(-c2ccc(OCCCCCCOC(=O)CC(C(=O)OCCCCCCOc3ccc(-c4ccc(C#N)cc4)cc3)S(=O)(=O)[O-])cc2)cc1.[Na+] |
| InChI | InChI=1S/C42H44N2O9S.Na/c43-30-32-9-13-34(14-10-32)36-17-21-38(22-18-36)50-25-5-1-3-7-27-52-41(45)29-40(54(47,48)49)42(46)53-28-8-4-2-6-26-51-39-23-19-37(20-24-39)35-15-11-33(31-44)12-16-35;/h9-24,40H,1-8,25-29H2,(H,47,48,49);/q;+1/p-1 |
| InChIKey | ZISPRCFHRYUTQP-UHFFFAOYSA-M |
| XLogP | 4.74 |
| TPSA | 175.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.87 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|