C27H44F6O11S — CID 58271632
5-heptoxy-1,5-dioxo-1-[6-(trifluoromethoxy)hexoxy]-3-[6-(trifluoromethoxy)hexoxycarbonyl]pentane-2-sulfonic acid (PubChem CID 58271632) has the molecular formula C27H44F6O11S and a molecular weight of 690.69 g/mol. Its IUPAC name is 5-heptoxy-1,5-dioxo-1-[6-(trifluoromethoxy)hexoxy]-3-[6-(trifluoromethoxy)hexoxycarbonyl]pentane-2-sulfonic acid.
| Compound Name | 5-heptoxy-1,5-dioxo-1-[6-(trifluoromethoxy)hexoxy]-3-[6-(trifluoromethoxy)hexoxycarbonyl]pentane-2-sulfonic acid |
|---|---|
| PubChem CID | 58271632 |
| Molecular Formula | C27H44F6O11S |
| Molecular Weight | 690.69 g/mol |
| Exact Mass | 690.25 |
| IUPAC Name | 5-heptoxy-1,5-dioxo-1-[6-(trifluoromethoxy)hexoxy]-3-[6-(trifluoromethoxy)hexoxycarbonyl]pentane-2-sulfonic acid |
| SMILES | CCCCCCCOC(=O)CC(C(=O)OCCCCCCOC(F)(F)F)C(C(=O)OCCCCCCOC(F)(F)F)S(=O)(=O)O |
| InChI | InChI=1S/C27H44F6O11S/c1-2-3-4-5-10-15-40-22(34)20-21(24(35)41-16-11-6-8-13-18-43-26(28,29)30)23(45(37,38)39)25(36)42-17-12-7-9-14-19-44-27(31,32)33/h21,23H,2-20H2,1H3,(H,37,38,39) |
| InChIKey | YLFFWJXIHCDAJL-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 151.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.69 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|