C18H32O9S — CID 23330080
1,5-dibutoxy-3-butoxycarbonyl-1,5-dioxopentane-2-sulfonic acid (PubChem CID 23330080) has the molecular formula C18H32O9S and a molecular weight of 424.51 g/mol. Its IUPAC name is 1,5-dibutoxy-3-butoxycarbonyl-1,5-dioxopentane-2-sulfonic acid.
| Compound Name | 1,5-dibutoxy-3-butoxycarbonyl-1,5-dioxopentane-2-sulfonic acid |
|---|---|
| PubChem CID | 23330080 |
| Molecular Formula | C18H32O9S |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 1,5-dibutoxy-3-butoxycarbonyl-1,5-dioxopentane-2-sulfonic acid |
| SMILES | CCCCOC(=O)CC(C(=O)OCCCC)C(C(=O)OCCCC)S(=O)(=O)O |
| InChI | InChI=1S/C18H32O9S/c1-4-7-10-25-15(19)13-14(17(20)26-11-8-5-2)16(28(22,23)24)18(21)27-12-9-6-3/h14,16H,4-13H2,1-3H3,(H,22,23,24) |
| InChIKey | XRLNPGHDMFTBTK-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|