C14H24O12S — CID 167698866
1-(ethoxymethoxy)-3-(ethoxymethoxycarbonyl)-5-(methoxymethoxy)-1,5-dioxopentane-2-sulfonic acid (PubChem CID 167698866) has the molecular formula C14H24O12S and a molecular weight of 416.40 g/mol. Its IUPAC name is 1-(ethoxymethoxy)-3-(ethoxymethoxycarbonyl)-5-(methoxymethoxy)-1,5-dioxopentane-2-sulfonic acid.
| Compound Name | 1-(ethoxymethoxy)-3-(ethoxymethoxycarbonyl)-5-(methoxymethoxy)-1,5-dioxopentane-2-sulfonic acid |
|---|---|
| PubChem CID | 167698866 |
| Molecular Formula | C14H24O12S |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | 1-(ethoxymethoxy)-3-(ethoxymethoxycarbonyl)-5-(methoxymethoxy)-1,5-dioxopentane-2-sulfonic acid |
| SMILES | CCOCOC(=O)C(CC(=O)OCOC)C(C(=O)OCOCC)S(=O)(=O)O |
| InChI | InChI=1S/C14H24O12S/c1-4-22-8-25-13(16)10(6-11(15)24-7-21-3)12(27(18,19)20)14(17)26-9-23-5-2/h10,12H,4-9H2,1-3H3,(H,18,19,20) |
| InChIKey | KPKRYCOEGPWPBX-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 160.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|