C5H8F2O6S — CID 118231624
2-(ethoxymethoxy)-1,1-difluoro-2-oxoethanesulfonic acid (PubChem CID 118231624) has the molecular formula C5H8F2O6S and a molecular weight of 234.18 g/mol. Its IUPAC name is 2-(ethoxymethoxy)-1,1-difluoro-2-oxoethanesulfonic acid.
| Compound Name | 2-(ethoxymethoxy)-1,1-difluoro-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 118231624 |
| Molecular Formula | C5H8F2O6S |
| Molecular Weight | 234.18 g/mol |
| Exact Mass | 234.00 |
| IUPAC Name | 2-(ethoxymethoxy)-1,1-difluoro-2-oxoethanesulfonic acid |
| SMILES | CCOCOC(=O)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C5H8F2O6S/c1-2-12-3-13-4(8)5(6,7)14(9,10)11/h2-3H2,1H3,(H,9,10,11) |
| InChIKey | BAQZVJVEYOCPOI-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.18 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|