C8H16F2O5SSi — CID 157431021
1,1-difluoro-2-oxo-2-triethylsilyloxyethanesulfonic acid (PubChem CID 157431021) has the molecular formula C8H16F2O5SSi and a molecular weight of 290.36 g/mol. Its IUPAC name is 1,1-difluoro-2-oxo-2-triethylsilyloxyethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-oxo-2-triethylsilyloxyethanesulfonic acid |
|---|---|
| PubChem CID | 157431021 |
| Molecular Formula | C8H16F2O5SSi |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 1,1-difluoro-2-oxo-2-triethylsilyloxyethanesulfonic acid |
| SMILES | CC[Si](CC)(CC)OC(=O)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C8H16F2O5SSi/c1-4-17(5-2,6-3)15-7(11)8(9,10)16(12,13)14/h4-6H2,1-3H3,(H,12,13,14) |
| InChIKey | BQNOTDLZJJXAJL-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|