C8H12F2O7S — CID 58903316
1,1-difluoro-2-(2-methylbutanoyloxymethoxy)-2-oxoethanesulfonic acid (PubChem CID 58903316) has the molecular formula C8H12F2O7S and a molecular weight of 290.24 g/mol. Its IUPAC name is 1,1-difluoro-2-(2-methylbutanoyloxymethoxy)-2-oxoethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-(2-methylbutanoyloxymethoxy)-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 58903316 |
| Molecular Formula | C8H12F2O7S |
| Molecular Weight | 290.24 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | 1,1-difluoro-2-(2-methylbutanoyloxymethoxy)-2-oxoethanesulfonic acid |
| SMILES | CCC(C)C(=O)OCOC(=O)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C8H12F2O7S/c1-3-5(2)6(11)16-4-17-7(12)8(9,10)18(13,14)15/h5H,3-4H2,1-2H3,(H,13,14,15) |
| InChIKey | GEAGCIUOILGVFW-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.24 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|