C16H26F4O8S — CID 121479999
1,1,2,2-tetrafluoro-4-[2-(2-methylbutanoyloxy)-1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]oxybutane-1-sulfonic acid (PubChem CID 121479999) has the molecular formula C16H26F4O8S and a molecular weight of 454.44 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-4-[2-(2-methylbutanoyloxy)-1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]oxybutane-1-sulfonic acid.
| Compound Name | 1,1,2,2-tetrafluoro-4-[2-(2-methylbutanoyloxy)-1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]oxybutane-1-sulfonic acid |
|---|---|
| PubChem CID | 121479999 |
| Molecular Formula | C16H26F4O8S |
| Molecular Weight | 454.44 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | 1,1,2,2-tetrafluoro-4-[2-(2-methylbutanoyloxy)-1-[(2-methylpropan-2-yl)oxy]-1-oxopropan-2-yl]oxybutane-1-sulfonic acid |
| SMILES | CCC(C)C(=O)OC(C)(OCCC(F)(F)C(F)(F)S(=O)(=O)O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H26F4O8S/c1-7-10(2)11(21)27-14(6,12(22)28-13(3,4)5)26-9-8-15(17,18)16(19,20)29(23,24)25/h10H,7-9H2,1-6H3,(H,23,24,25) |
| InChIKey | XAZYHRKKRPCHMH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.44 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|