C23H37F7O8S — CID 138551319
4-[3-ethoxy-1,1,1-trifluoro-3-oxo-2-[2,4,4-trimethyl-2-(2-methylbutan-2-yl)hexanoyl]oxypropan-2-yl]oxy-1,1,2,2-tetrafluorobutane-1-sulfonic acid (PubChem CID 138551319) has the molecular formula C23H37F7O8S and a molecular weight of 606.59 g/mol. Its IUPAC name is 4-[3-ethoxy-1,1,1-trifluoro-3-oxo-2-[2,4,4-trimethyl-2-(2-methylbutan-2-yl)hexanoyl]oxypropan-2-yl]oxy-1,1,2,2-tetrafluorobutane-1-sulfonic acid.
| Compound Name | 4-[3-ethoxy-1,1,1-trifluoro-3-oxo-2-[2,4,4-trimethyl-2-(2-methylbutan-2-yl)hexanoyl]oxypropan-2-yl]oxy-1,1,2,2-tetrafluorobutane-1-sulfonic acid |
|---|---|
| PubChem CID | 138551319 |
| Molecular Formula | C23H37F7O8S |
| Molecular Weight | 606.59 g/mol |
| Exact Mass | 606.21 |
| IUPAC Name | 4-[3-ethoxy-1,1,1-trifluoro-3-oxo-2-[2,4,4-trimethyl-2-(2-methylbutan-2-yl)hexanoyl]oxypropan-2-yl]oxy-1,1,2,2-tetrafluorobutane-1-sulfonic acid |
| SMILES | CCOC(=O)C(OCCC(F)(F)C(F)(F)S(=O)(=O)O)(OC(=O)C(C)(CC(C)(C)CC)C(C)(C)CC)C(F)(F)F |
| InChI | InChI=1S/C23H37F7O8S/c1-9-17(4,5)14-19(8,18(6,7)10-2)15(31)38-21(22(26,27)28,16(32)36-11-3)37-13-12-20(24,25)23(29,30)39(33,34)35/h9-14H2,1-8H3,(H,33,34,35) |
| InChIKey | KGTXEXWLIQBHPV-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.59 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|