C18H17F7O8S — CID 161290939
1,1,2,2-tetrafluoro-4-[1,1,1-trifluoro-3-(4-methylphenoxy)-2-(2-methylprop-2-enoyloxy)-3-oxopropan-2-yl]oxybutane-1-sulfonic acid (PubChem CID 161290939) has the molecular formula C18H17F7O8S and a molecular weight of 526.38 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-4-[1,1,1-trifluoro-3-(4-methylphenoxy)-2-(2-methylprop-2-enoyloxy)-3-oxopropan-2-yl]oxybutane-1-sulfonic acid.
| Compound Name | 1,1,2,2-tetrafluoro-4-[1,1,1-trifluoro-3-(4-methylphenoxy)-2-(2-methylprop-2-enoyloxy)-3-oxopropan-2-yl]oxybutane-1-sulfonic acid |
|---|---|
| PubChem CID | 161290939 |
| Molecular Formula | C18H17F7O8S |
| Molecular Weight | 526.38 g/mol |
| Exact Mass | 526.05 |
| IUPAC Name | 1,1,2,2-tetrafluoro-4-[1,1,1-trifluoro-3-(4-methylphenoxy)-2-(2-methylprop-2-enoyloxy)-3-oxopropan-2-yl]oxybutane-1-sulfonic acid |
| SMILES | C=C(C)C(=O)OC(OCCC(F)(F)C(F)(F)S(=O)(=O)O)(C(=O)Oc1ccc(C)cc1)C(F)(F)F |
| InChI | InChI=1S/C18H17F7O8S/c1-10(2)13(26)33-16(17(21,22)23,14(27)32-12-6-4-11(3)5-7-12)31-9-8-15(19,20)18(24,25)34(28,29)30/h4-7H,1,8-9H2,2-3H3,(H,28,29,30) |
| InChIKey | LGZGKXYQYISTAX-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.38 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|