C13H16F7NO7S — CID 140614307
4-[3-(ethylamino)-1,1,1-trifluoro-2-(2-methylprop-2-enoyloxy)-3-oxopropan-2-yl]oxy-1,1,2,2-tetrafluorobutane-1-sulfonic acid (PubChem CID 140614307) has the molecular formula C13H16F7NO7S and a molecular weight of 463.32 g/mol. Its IUPAC name is 4-[3-(ethylamino)-1,1,1-trifluoro-2-(2-methylprop-2-enoyloxy)-3-oxopropan-2-yl]oxy-1,1,2,2-tetrafluorobutane-1-sulfonic acid.
| Compound Name | 4-[3-(ethylamino)-1,1,1-trifluoro-2-(2-methylprop-2-enoyloxy)-3-oxopropan-2-yl]oxy-1,1,2,2-tetrafluorobutane-1-sulfonic acid |
|---|---|
| PubChem CID | 140614307 |
| Molecular Formula | C13H16F7NO7S |
| Molecular Weight | 463.32 g/mol |
| Exact Mass | 463.05 |
| IUPAC Name | 4-[3-(ethylamino)-1,1,1-trifluoro-2-(2-methylprop-2-enoyloxy)-3-oxopropan-2-yl]oxy-1,1,2,2-tetrafluorobutane-1-sulfonic acid |
| SMILES | C=C(C)C(=O)OC(OCCC(F)(F)C(F)(F)S(=O)(=O)O)(C(=O)NCC)C(F)(F)F |
| InChI | InChI=1S/C13H16F7NO7S/c1-4-21-9(23)11(12(16,17)18,28-8(22)7(2)3)27-6-5-10(14,15)13(19,20)29(24,25)26/h2,4-6H2,1,3H3,(H,21,23)(H,24,25,26) |
| InChIKey | HQQAREHRTJTWNX-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.32 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|