C12H15F5NO7S- — CID 140614382
3-[3-(ethylamino)-1,1,1-trifluoro-2-(2-methylprop-2-enoyloxy)-3-oxopropan-2-yl]oxy-1,1-difluoropropane-1-sulfonate (PubChem CID 140614382) has the molecular formula C12H15F5NO7S- and a molecular weight of 412.31 g/mol. Its IUPAC name is 3-[3-(ethylamino)-1,1,1-trifluoro-2-(2-methylprop-2-enoyloxy)-3-oxopropan-2-yl]oxy-1,1-difluoropropane-1-sulfonate.
| Compound Name | 3-[3-(ethylamino)-1,1,1-trifluoro-2-(2-methylprop-2-enoyloxy)-3-oxopropan-2-yl]oxy-1,1-difluoropropane-1-sulfonate |
|---|---|
| PubChem CID | 140614382 |
| Molecular Formula | C12H15F5NO7S- |
| Molecular Weight | 412.31 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | 3-[3-(ethylamino)-1,1,1-trifluoro-2-(2-methylprop-2-enoyloxy)-3-oxopropan-2-yl]oxy-1,1-difluoropropane-1-sulfonate |
| SMILES | C=C(C)C(=O)OC(OCCC(F)(F)S(=O)(=O)[O-])(C(=O)NCC)C(F)(F)F |
| InChI | InChI=1S/C12H16F5NO7S/c1-4-18-9(20)11(12(15,16)17,25-8(19)7(2)3)24-6-5-10(13,14)26(21,22)23/h2,4-6H2,1,3H3,(H,18,20)(H,21,22,23)/p-1 |
| InChIKey | FPPCWZJOZYUYKT-UHFFFAOYSA-M |
| XLogP | 1.05 |
| TPSA | 121.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.31 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|