C11H9F6O8S- — CID 140614503
3-[3-ethenoxy-1,1,1-trifluoro-2-(2-fluoroprop-2-enoyloxy)-3-oxopropan-2-yl]oxy-1,1-difluoropropane-1-sulfonate (PubChem CID 140614503) has the molecular formula C11H9F6O8S- and a molecular weight of 415.24 g/mol. Its IUPAC name is 3-[3-ethenoxy-1,1,1-trifluoro-2-(2-fluoroprop-2-enoyloxy)-3-oxopropan-2-yl]oxy-1,1-difluoropropane-1-sulfonate.
| Compound Name | 3-[3-ethenoxy-1,1,1-trifluoro-2-(2-fluoroprop-2-enoyloxy)-3-oxopropan-2-yl]oxy-1,1-difluoropropane-1-sulfonate |
|---|---|
| PubChem CID | 140614503 |
| Molecular Formula | C11H9F6O8S- |
| Molecular Weight | 415.24 g/mol |
| Exact Mass | 414.99 |
| IUPAC Name | 3-[3-ethenoxy-1,1,1-trifluoro-2-(2-fluoroprop-2-enoyloxy)-3-oxopropan-2-yl]oxy-1,1-difluoropropane-1-sulfonate |
| SMILES | C=COC(=O)C(OCCC(F)(F)S(=O)(=O)[O-])(OC(=O)C(=C)F)C(F)(F)F |
| InChI | InChI=1S/C11H10F6O8S/c1-3-23-8(19)10(11(15,16)17,25-7(18)6(2)12)24-5-4-9(13,14)26(20,21)22/h3H,1-2,4-5H2,(H,20,21,22)/p-1 |
| InChIKey | UQCLKRMMIHQPHG-UHFFFAOYSA-M |
| XLogP | 1.50 |
| TPSA | 119.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.24 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|