C15H21F5NO7S- — CID 140614688
3-[3-(dipropylamino)-1,1,1-trifluoro-3-oxo-2-prop-2-enoyloxypropan-2-yl]oxy-1,1-difluoropropane-1-sulfonate (PubChem CID 140614688) has the molecular formula C15H21F5NO7S- and a molecular weight of 454.39 g/mol. Its IUPAC name is 3-[3-(dipropylamino)-1,1,1-trifluoro-3-oxo-2-prop-2-enoyloxypropan-2-yl]oxy-1,1-difluoropropane-1-sulfonate.
| Compound Name | 3-[3-(dipropylamino)-1,1,1-trifluoro-3-oxo-2-prop-2-enoyloxypropan-2-yl]oxy-1,1-difluoropropane-1-sulfonate |
|---|---|
| PubChem CID | 140614688 |
| Molecular Formula | C15H21F5NO7S- |
| Molecular Weight | 454.39 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | 3-[3-(dipropylamino)-1,1,1-trifluoro-3-oxo-2-prop-2-enoyloxypropan-2-yl]oxy-1,1-difluoropropane-1-sulfonate |
| SMILES | C=CC(=O)OC(OCCC(F)(F)S(=O)(=O)[O-])(C(=O)N(CCC)CCC)C(F)(F)F |
| InChI | InChI=1S/C15H22F5NO7S/c1-4-8-21(9-5-2)12(23)14(15(18,19)20,28-11(22)6-3)27-10-7-13(16,17)29(24,25)26/h6H,3-5,7-10H2,1-2H3,(H,24,25,26)/p-1 |
| InChIKey | BTOAOCRNYWQBAG-UHFFFAOYSA-M |
| XLogP | 2.17 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.39 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|