C13H12F7O9S- — CID 140614740
1,1,2,2-tetrafluoro-4-[1,1,1-trifluoro-3-oxo-3-(2-oxopropoxy)-2-prop-2-enoyloxypropan-2-yl]oxybutane-1-sulfonate (PubChem CID 140614740) has the molecular formula C13H12F7O9S- and a molecular weight of 477.28 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-4-[1,1,1-trifluoro-3-oxo-3-(2-oxopropoxy)-2-prop-2-enoyloxypropan-2-yl]oxybutane-1-sulfonate.
| Compound Name | 1,1,2,2-tetrafluoro-4-[1,1,1-trifluoro-3-oxo-3-(2-oxopropoxy)-2-prop-2-enoyloxypropan-2-yl]oxybutane-1-sulfonate |
|---|---|
| PubChem CID | 140614740 |
| Molecular Formula | C13H12F7O9S- |
| Molecular Weight | 477.28 g/mol |
| Exact Mass | 477.01 |
| IUPAC Name | 1,1,2,2-tetrafluoro-4-[1,1,1-trifluoro-3-oxo-3-(2-oxopropoxy)-2-prop-2-enoyloxypropan-2-yl]oxybutane-1-sulfonate |
| SMILES | C=CC(=O)OC(OCCC(F)(F)C(F)(F)S(=O)(=O)[O-])(C(=O)OCC(C)=O)C(F)(F)F |
| InChI | InChI=1S/C13H13F7O9S/c1-3-8(22)29-11(12(16,17)18,9(23)27-6-7(2)21)28-5-4-10(14,15)13(19,20)30(24,25)26/h3H,1,4-6H2,2H3,(H,24,25,26)/p-1 |
| InChIKey | ZBLSWDCXOPDULO-UHFFFAOYSA-M |
| XLogP | 1.29 |
| TPSA | 136.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.28 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|