C14H17F7O5S — CID 88552012
tert-butyl 3,3,3-trifluoro-2-prop-2-enoyloxy-2-(3,3,4,4-tetrafluoro-4-sulfanylbutoxy)propanoate (PubChem CID 88552012) has the molecular formula C14H17F7O5S and a molecular weight of 430.34 g/mol. Its IUPAC name is tert-butyl 3,3,3-trifluoro-2-prop-2-enoyloxy-2-(3,3,4,4-tetrafluoro-4-sulfanylbutoxy)propanoate.
| Compound Name | tert-butyl 3,3,3-trifluoro-2-prop-2-enoyloxy-2-(3,3,4,4-tetrafluoro-4-sulfanylbutoxy)propanoate |
|---|---|
| PubChem CID | 88552012 |
| Molecular Formula | C14H17F7O5S |
| Molecular Weight | 430.34 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | tert-butyl 3,3,3-trifluoro-2-prop-2-enoyloxy-2-(3,3,4,4-tetrafluoro-4-sulfanylbutoxy)propanoate |
| SMILES | C=CC(=O)OC(OCCC(F)(F)C(F)(F)S)(C(=O)OC(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C14H17F7O5S/c1-5-8(22)25-12(13(17,18)19,9(23)26-10(2,3)4)24-7-6-11(15,16)14(20,21)27/h5,27H,1,6-7H2,2-4H3 |
| InChIKey | UWXJAMSYKFTJAS-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 61.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.34 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|