C12H16F5NO4S — CID 88551954
[2-(3,3-difluoro-3-sulfanylpropoxy)-1,1,1-trifluoro-3-oxo-3-(propylamino)propan-2-yl] prop-2-enoate (PubChem CID 88551954) has the molecular formula C12H16F5NO4S and a molecular weight of 365.32 g/mol. Its IUPAC name is [2-(3,3-difluoro-3-sulfanylpropoxy)-1,1,1-trifluoro-3-oxo-3-(propylamino)propan-2-yl] prop-2-enoate.
| Compound Name | [2-(3,3-difluoro-3-sulfanylpropoxy)-1,1,1-trifluoro-3-oxo-3-(propylamino)propan-2-yl] prop-2-enoate |
|---|---|
| PubChem CID | 88551954 |
| Molecular Formula | C12H16F5NO4S |
| Molecular Weight | 365.32 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | [2-(3,3-difluoro-3-sulfanylpropoxy)-1,1,1-trifluoro-3-oxo-3-(propylamino)propan-2-yl] prop-2-enoate |
| SMILES | C=CC(=O)OC(OCCC(F)(F)S)(C(=O)NCCC)C(F)(F)F |
| InChI | InChI=1S/C12H16F5NO4S/c1-3-6-18-9(20)11(12(15,16)17,22-8(19)4-2)21-7-5-10(13,14)23/h4,23H,2-3,5-7H2,1H3,(H,18,20) |
| InChIKey | WJTPUXIRURWEIB-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|