C17H15F7O5 — CID 163433946
phenyl 3,3,3-trifluoro-2-prop-2-enoyloxy-2-(3,3,4,4-tetrafluoropentoxy)propanoate (PubChem CID 163433946) has the molecular formula C17H15F7O5 and a molecular weight of 432.29 g/mol. Its IUPAC name is phenyl 3,3,3-trifluoro-2-prop-2-enoyloxy-2-(3,3,4,4-tetrafluoropentoxy)propanoate.
| Compound Name | phenyl 3,3,3-trifluoro-2-prop-2-enoyloxy-2-(3,3,4,4-tetrafluoropentoxy)propanoate |
|---|---|
| PubChem CID | 163433946 |
| Molecular Formula | C17H15F7O5 |
| Molecular Weight | 432.29 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | phenyl 3,3,3-trifluoro-2-prop-2-enoyloxy-2-(3,3,4,4-tetrafluoropentoxy)propanoate |
| SMILES | C=CC(=O)OC(OCCC(F)(F)C(C)(F)F)(C(=O)Oc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C17H15F7O5/c1-3-12(25)29-16(17(22,23)24,13(26)28-11-7-5-4-6-8-11)27-10-9-15(20,21)14(2,18)19/h3-8H,1,9-10H2,2H3 |
| InChIKey | ASWGAIWHRULRGP-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.29 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|