C20H15F13O5S — CID 88552045
[1,1,1-trifluoro-3-oxo-2-(5,5,6,6-tetrafluoro-6-sulfanylhexoxy)-3-[4-(trifluoromethyl)phenoxy]propan-2-yl] 2-(trifluoromethyl)prop-2-enoate (PubChem CID 88552045) has the molecular formula C20H15F13O5S and a molecular weight of 614.38 g/mol. Its IUPAC name is [1,1,1-trifluoro-3-oxo-2-(5,5,6,6-tetrafluoro-6-sulfanylhexoxy)-3-[4-(trifluoromethyl)phenoxy]propan-2-yl] 2-(trifluoromethyl)prop-2-enoate.
| Compound Name | [1,1,1-trifluoro-3-oxo-2-(5,5,6,6-tetrafluoro-6-sulfanylhexoxy)-3-[4-(trifluoromethyl)phenoxy]propan-2-yl] 2-(trifluoromethyl)prop-2-enoate |
|---|---|
| PubChem CID | 88552045 |
| Molecular Formula | C20H15F13O5S |
| Molecular Weight | 614.38 g/mol |
| Exact Mass | 614.04 |
| IUPAC Name | [1,1,1-trifluoro-3-oxo-2-(5,5,6,6-tetrafluoro-6-sulfanylhexoxy)-3-[4-(trifluoromethyl)phenoxy]propan-2-yl] 2-(trifluoromethyl)prop-2-enoate |
| SMILES | C=C(C(=O)OC(OCCCCC(F)(F)C(F)(F)S)(C(=O)Oc1ccc(C(F)(F)F)cc1)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C20H15F13O5S/c1-10(17(23,24)25)13(34)38-16(19(29,30)31,36-9-3-2-8-15(21,22)20(32,33)39)14(35)37-12-6-4-11(5-7-12)18(26,27)28/h4-7,39H,1-3,8-9H2 |
| InChIKey | IORWJXXRTSTQGQ-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 61.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.38 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|