C15H17F10NO4S — CID 88551694
[3-(dimethylamino)-1,1,1-trifluoro-3-oxo-2-(5,5,6,6-tetrafluoro-6-sulfanylhexoxy)propan-2-yl] 2-(trifluoromethyl)prop-2-enoate (PubChem CID 88551694) has the molecular formula C15H17F10NO4S and a molecular weight of 497.35 g/mol. Its IUPAC name is [3-(dimethylamino)-1,1,1-trifluoro-3-oxo-2-(5,5,6,6-tetrafluoro-6-sulfanylhexoxy)propan-2-yl] 2-(trifluoromethyl)prop-2-enoate.
| Compound Name | [3-(dimethylamino)-1,1,1-trifluoro-3-oxo-2-(5,5,6,6-tetrafluoro-6-sulfanylhexoxy)propan-2-yl] 2-(trifluoromethyl)prop-2-enoate |
|---|---|
| PubChem CID | 88551694 |
| Molecular Formula | C15H17F10NO4S |
| Molecular Weight | 497.35 g/mol |
| Exact Mass | 497.07 |
| IUPAC Name | [3-(dimethylamino)-1,1,1-trifluoro-3-oxo-2-(5,5,6,6-tetrafluoro-6-sulfanylhexoxy)propan-2-yl] 2-(trifluoromethyl)prop-2-enoate |
| SMILES | C=C(C(=O)OC(OCCCCC(F)(F)C(F)(F)S)(C(=O)N(C)C)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H17F10NO4S/c1-8(13(18,19)20)9(27)30-12(14(21,22)23,10(28)26(2)3)29-7-5-4-6-11(16,17)15(24,25)31/h31H,1,4-7H2,2-3H3 |
| InChIKey | CJIHKSWZLRBKSQ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 55.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.35 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|