C15H18F9NO4S — CID 88551934
[3-(ethylamino)-1,1,1-trifluoro-3-oxo-2-(5,5,6-trifluoro-6-sulfanylhexoxy)propan-2-yl] 2-(trifluoromethyl)prop-2-enoate (PubChem CID 88551934) has the molecular formula C15H18F9NO4S and a molecular weight of 479.36 g/mol. Its IUPAC name is [3-(ethylamino)-1,1,1-trifluoro-3-oxo-2-(5,5,6-trifluoro-6-sulfanylhexoxy)propan-2-yl] 2-(trifluoromethyl)prop-2-enoate.
| Compound Name | [3-(ethylamino)-1,1,1-trifluoro-3-oxo-2-(5,5,6-trifluoro-6-sulfanylhexoxy)propan-2-yl] 2-(trifluoromethyl)prop-2-enoate |
|---|---|
| PubChem CID | 88551934 |
| Molecular Formula | C15H18F9NO4S |
| Molecular Weight | 479.36 g/mol |
| Exact Mass | 479.08 |
| IUPAC Name | [3-(ethylamino)-1,1,1-trifluoro-3-oxo-2-(5,5,6-trifluoro-6-sulfanylhexoxy)propan-2-yl] 2-(trifluoromethyl)prop-2-enoate |
| SMILES | C=C(C(=O)OC(OCCCCC(F)(F)C(F)S)(C(=O)NCC)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H18F9NO4S/c1-3-25-11(27)13(15(22,23)24,29-9(26)8(2)14(19,20)21)28-7-5-4-6-12(17,18)10(16)30/h10,30H,2-7H2,1H3,(H,25,27) |
| InChIKey | NCZDPDNPJIIDRP-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.36 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|