C17H20F10NO7S- — CID 140614614
1,1,2,2-tetrafluoro-6-[1,1,1-trifluoro-3-(2-methylpropylamino)-3-oxo-2-[2-(trifluoromethyl)prop-2-enoyloxy]propan-2-yl]oxyhexane-1-sulfonate (PubChem CID 140614614) has the molecular formula C17H20F10NO7S- and a molecular weight of 572.39 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-6-[1,1,1-trifluoro-3-(2-methylpropylamino)-3-oxo-2-[2-(trifluoromethyl)prop-2-enoyloxy]propan-2-yl]oxyhexane-1-sulfonate.
| Compound Name | 1,1,2,2-tetrafluoro-6-[1,1,1-trifluoro-3-(2-methylpropylamino)-3-oxo-2-[2-(trifluoromethyl)prop-2-enoyloxy]propan-2-yl]oxyhexane-1-sulfonate |
|---|---|
| PubChem CID | 140614614 |
| Molecular Formula | C17H20F10NO7S- |
| Molecular Weight | 572.39 g/mol |
| Exact Mass | 572.08 |
| IUPAC Name | 1,1,2,2-tetrafluoro-6-[1,1,1-trifluoro-3-(2-methylpropylamino)-3-oxo-2-[2-(trifluoromethyl)prop-2-enoyloxy]propan-2-yl]oxyhexane-1-sulfonate |
| SMILES | C=C(C(=O)OC(OCCCCC(F)(F)C(F)(F)S(=O)(=O)[O-])(C(=O)NCC(C)C)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C17H21F10NO7S/c1-9(2)8-28-12(30)14(16(23,24)25,35-11(29)10(3)15(20,21)22)34-7-5-4-6-13(18,19)17(26,27)36(31,32)33/h9H,3-8H2,1-2H3,(H,28,30)(H,31,32,33)/p-1 |
| InChIKey | SGMGXHVOVQABNN-UHFFFAOYSA-M |
| XLogP | 3.64 |
| TPSA | 121.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|