C16H18F10NO7S- — CID 140614598
1,1,2,2-tetrafluoro-6-[1,1,1-trifluoro-3-oxo-3-(propylamino)-2-[2-(trifluoromethyl)prop-2-enoyloxy]propan-2-yl]oxyhexane-1-sulfonate (PubChem CID 140614598) has the molecular formula C16H18F10NO7S- and a molecular weight of 558.37 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-6-[1,1,1-trifluoro-3-oxo-3-(propylamino)-2-[2-(trifluoromethyl)prop-2-enoyloxy]propan-2-yl]oxyhexane-1-sulfonate.
| Compound Name | 1,1,2,2-tetrafluoro-6-[1,1,1-trifluoro-3-oxo-3-(propylamino)-2-[2-(trifluoromethyl)prop-2-enoyloxy]propan-2-yl]oxyhexane-1-sulfonate |
|---|---|
| PubChem CID | 140614598 |
| Molecular Formula | C16H18F10NO7S- |
| Molecular Weight | 558.37 g/mol |
| Exact Mass | 558.06 |
| IUPAC Name | 1,1,2,2-tetrafluoro-6-[1,1,1-trifluoro-3-oxo-3-(propylamino)-2-[2-(trifluoromethyl)prop-2-enoyloxy]propan-2-yl]oxyhexane-1-sulfonate |
| SMILES | C=C(C(=O)OC(OCCCCC(F)(F)C(F)(F)S(=O)(=O)[O-])(C(=O)NCCC)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H19F10NO7S/c1-3-7-27-11(29)13(15(22,23)24,34-10(28)9(2)14(19,20)21)33-8-5-4-6-12(17,18)16(25,26)35(30,31)32/h2-8H2,1H3,(H,27,29)(H,30,31,32)/p-1 |
| InChIKey | AEUWFWJHGDTVQB-UHFFFAOYSA-M |
| XLogP | 3.39 |
| TPSA | 121.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.37 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|