C14H14F8NO7S- — CID 140614413
6-[3-(ethenylamino)-1,1,1-trifluoro-2-(2-fluoroprop-2-enoyloxy)-3-oxopropan-2-yl]oxy-1,1,2,2-tetrafluorohexane-1-sulfonate (PubChem CID 140614413) has the molecular formula C14H14F8NO7S- and a molecular weight of 492.32 g/mol. Its IUPAC name is 6-[3-(ethenylamino)-1,1,1-trifluoro-2-(2-fluoroprop-2-enoyloxy)-3-oxopropan-2-yl]oxy-1,1,2,2-tetrafluorohexane-1-sulfonate.
| Compound Name | 6-[3-(ethenylamino)-1,1,1-trifluoro-2-(2-fluoroprop-2-enoyloxy)-3-oxopropan-2-yl]oxy-1,1,2,2-tetrafluorohexane-1-sulfonate |
|---|---|
| PubChem CID | 140614413 |
| Molecular Formula | C14H14F8NO7S- |
| Molecular Weight | 492.32 g/mol |
| Exact Mass | 492.04 |
| IUPAC Name | 6-[3-(ethenylamino)-1,1,1-trifluoro-2-(2-fluoroprop-2-enoyloxy)-3-oxopropan-2-yl]oxy-1,1,2,2-tetrafluorohexane-1-sulfonate |
| SMILES | C=CNC(=O)C(OCCCCC(F)(F)C(F)(F)S(=O)(=O)[O-])(OC(=O)C(=C)F)C(F)(F)F |
| InChI | InChI=1S/C14H15F8NO7S/c1-3-23-10(25)12(13(18,19)20,30-9(24)8(2)15)29-7-5-4-6-11(16,17)14(21,22)31(26,27)28/h3H,1-2,4-7H2,(H,23,25)(H,26,27,28)/p-1 |
| InChIKey | QYXIWWOTYTZPAV-UHFFFAOYSA-M |
| XLogP | 2.49 |
| TPSA | 121.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.32 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|