C20H25F7O9S — CID 89094370
4-[3-ethoxy-1,1,1-trifluoro-2-(3-hydroxyadamantane-1-carbonyl)oxy-3-oxopropan-2-yl]oxy-1,1,2,2-tetrafluorobutane-1-sulfonic acid (PubChem CID 89094370) has the molecular formula C20H25F7O9S and a molecular weight of 574.46 g/mol. Its IUPAC name is 4-[3-ethoxy-1,1,1-trifluoro-2-(3-hydroxyadamantane-1-carbonyl)oxy-3-oxopropan-2-yl]oxy-1,1,2,2-tetrafluorobutane-1-sulfonic acid.
| Compound Name | 4-[3-ethoxy-1,1,1-trifluoro-2-(3-hydroxyadamantane-1-carbonyl)oxy-3-oxopropan-2-yl]oxy-1,1,2,2-tetrafluorobutane-1-sulfonic acid |
|---|---|
| PubChem CID | 89094370 |
| Molecular Formula | C20H25F7O9S |
| Molecular Weight | 574.46 g/mol |
| Exact Mass | 574.11 |
| IUPAC Name | 4-[3-ethoxy-1,1,1-trifluoro-2-(3-hydroxyadamantane-1-carbonyl)oxy-3-oxopropan-2-yl]oxy-1,1,2,2-tetrafluorobutane-1-sulfonic acid |
| SMILES | CCOC(=O)C(OCCC(F)(F)C(F)(F)S(=O)(=O)O)(OC(=O)C12CC3CC(CC(O)(C3)C1)C2)C(F)(F)F |
| InChI | InChI=1S/C20H25F7O9S/c1-2-34-14(29)18(19(23,24)25,35-4-3-17(21,22)20(26,27)37(31,32)33)36-13(28)15-6-11-5-12(7-15)9-16(30,8-11)10-15/h11-12,30H,2-10H2,1H3,(H,31,32,33) |
| InChIKey | ZKMPICTUECKVLT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.46 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|