C40H43F7O8S2 — CID 159049689
6-[2-(adamantane-1-carbonyloxy)-3-ethoxy-1,1,1-trifluoro-3-oxopropan-2-yl]oxy-1,1,2,2-tetrafluorohexane-1-sulfonate;triphenylsulfanium (PubChem CID 159049689) has the molecular formula C40H43F7O8S2 and a molecular weight of 848.90 g/mol. Its IUPAC name is 6-[2-(adamantane-1-carbonyloxy)-3-ethoxy-1,1,1-trifluoro-3-oxopropan-2-yl]oxy-1,1,2,2-tetrafluorohexane-1-sulfonate;triphenylsulfanium.
| Compound Name | 6-[2-(adamantane-1-carbonyloxy)-3-ethoxy-1,1,1-trifluoro-3-oxopropan-2-yl]oxy-1,1,2,2-tetrafluorohexane-1-sulfonate;triphenylsulfanium |
|---|---|
| PubChem CID | 159049689 |
| Molecular Formula | C40H43F7O8S2 |
| Molecular Weight | 848.90 g/mol |
| Exact Mass | 848.23 |
| IUPAC Name | 6-[2-(adamantane-1-carbonyloxy)-3-ethoxy-1,1,1-trifluoro-3-oxopropan-2-yl]oxy-1,1,2,2-tetrafluorohexane-1-sulfonate;triphenylsulfanium |
| SMILES | CCOC(=O)C(OCCCCC(F)(F)C(F)(F)S(=O)(=O)[O-])(OC(=O)C12CC3CC(CC(C3)C1)C2)C(F)(F)F.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H29F7O8S.C18H15S/c1-2-35-17(31)20(21(25,26)27,36-6-4-3-5-19(23,24)22(28,29)38(32,33)34)37-16(30)18-10-13-7-14(11-18)9-15(8-13)12-18;1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h13-15H,2-12H2,1H3,(H,32,33,34);1-15H/q;+1/p-1 |
| InChIKey | JXCLVKIDVKPQAY-UHFFFAOYSA-M |
| XLogP | 9.31 |
| TPSA | 119.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 848.90 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|