C21H25F7O6 — CID 89087132
[3-ethoxy-1,1,1-trifluoro-3-oxo-2-(3,3,4,4-tetrafluoropentoxy)propan-2-yl] 4-oxoadamantane-1-carboxylate (PubChem CID 89087132) has the molecular formula C21H25F7O6 and a molecular weight of 506.41 g/mol. Its IUPAC name is [3-ethoxy-1,1,1-trifluoro-3-oxo-2-(3,3,4,4-tetrafluoropentoxy)propan-2-yl] 4-oxoadamantane-1-carboxylate.
| Compound Name | [3-ethoxy-1,1,1-trifluoro-3-oxo-2-(3,3,4,4-tetrafluoropentoxy)propan-2-yl] 4-oxoadamantane-1-carboxylate |
|---|---|
| PubChem CID | 89087132 |
| Molecular Formula | C21H25F7O6 |
| Molecular Weight | 506.41 g/mol |
| Exact Mass | 506.15 |
| IUPAC Name | [3-ethoxy-1,1,1-trifluoro-3-oxo-2-(3,3,4,4-tetrafluoropentoxy)propan-2-yl] 4-oxoadamantane-1-carboxylate |
| SMILES | CCOC(=O)C(OCCC(F)(F)C(C)(F)F)(OC(=O)C12CC3CC(C1)C(=O)C(C3)C2)C(F)(F)F |
| InChI | InChI=1S/C21H25F7O6/c1-3-32-16(31)20(21(26,27)28,33-5-4-19(24,25)17(2,22)23)34-15(30)18-8-11-6-12(9-18)14(29)13(7-11)10-18/h11-13H,3-10H2,1-2H3 |
| InChIKey | GOTWWYWWIOWEOM-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.41 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|