C20H24F7O9S- — CID 169026983
[3-ethoxy-1,1,1-trifluoro-3-oxo-2-(3,3,4,4-tetrafluoro-4-oxidoperoxysulfanylbutoxy)propan-2-yl] 3-hydroxyadamantane-1-carboxylate (PubChem CID 169026983) has the molecular formula C20H24F7O9S- and a molecular weight of 573.46 g/mol. Its IUPAC name is [3-ethoxy-1,1,1-trifluoro-3-oxo-2-(3,3,4,4-tetrafluoro-4-oxidoperoxysulfanylbutoxy)propan-2-yl] 3-hydroxyadamantane-1-carboxylate.
| Compound Name | [3-ethoxy-1,1,1-trifluoro-3-oxo-2-(3,3,4,4-tetrafluoro-4-oxidoperoxysulfanylbutoxy)propan-2-yl] 3-hydroxyadamantane-1-carboxylate |
|---|---|
| PubChem CID | 169026983 |
| Molecular Formula | C20H24F7O9S- |
| Molecular Weight | 573.46 g/mol |
| Exact Mass | 573.10 |
| IUPAC Name | [3-ethoxy-1,1,1-trifluoro-3-oxo-2-(3,3,4,4-tetrafluoro-4-oxidoperoxysulfanylbutoxy)propan-2-yl] 3-hydroxyadamantane-1-carboxylate |
| SMILES | CCOC(=O)C(OCCC(F)(F)C(F)(F)SOO[O-])(OC(=O)C12CC3CC(CC(O)(C3)C1)C2)C(F)(F)F |
| InChI | InChI=1S/C20H25F7O9S/c1-2-32-14(29)18(19(23,24)25,33-4-3-17(21,22)20(26,27)37-36-35-31)34-13(28)15-6-11-5-12(7-15)9-16(30,8-11)10-15/h11-12,30-31H,2-10H2,1H3/p-1 |
| InChIKey | NQEAEOUSLVTBES-UHFFFAOYSA-M |
| XLogP | 3.19 |
| TPSA | 123.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.46 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|