2-(2,3-dihydroxypropoxy)-1,1-difluoro-2-oxoethanesulfonic acid

C5H8F2O7S — CID 58021584

IUPAC2-(2,3-dihydroxypropoxy)-1,1-difluoro-2-oxoethanesulfonic acid
SMILESO=C(OCC(O)CO)C(F)(F)S(=O)(=O)O
InChIInChI=1S/C5H8F2O7S/c6-5(7,15(11,12)13)4(10)14-2-3(9)1-8/h3,8-9H,1-2H2,(H,11,12,13)
InChIKeyMCJYRLMMQBQHOG-UHFFFAOYSA-N
MW250.17 g/mol
LogP-1.64
Rot. Bonds5

About 2-(2,3-dihydroxypropoxy)-1,1-difluoro-2-oxoethanesulfonic acid

2-(2,3-dihydroxypropoxy)-1,1-difluoro-2-oxoethanesulfonic acid (PubChem CID 58021584) has the molecular formula C5H8F2O7S and a molecular weight of 250.17 g/mol. Its IUPAC name is 2-(2,3-dihydroxypropoxy)-1,1-difluoro-2-oxoethanesulfonic acid.

Molecular Properties

Compound Name2-(2,3-dihydroxypropoxy)-1,1-difluoro-2-oxoethanesulfonic acid
PubChem CID58021584
Molecular FormulaC5H8F2O7S
Molecular Weight250.17 g/mol
Exact Mass250.00
IUPAC Name2-(2,3-dihydroxypropoxy)-1,1-difluoro-2-oxoethanesulfonic acid
SMILESO=C(OCC(O)CO)C(F)(F)S(=O)(=O)O
InChIInChI=1S/C5H8F2O7S/c6-5(7,15(11,12)13)4(10)14-2-3(9)1-8/h3,8-9H,1-2H2,(H,11,12,13)
InChIKeyMCJYRLMMQBQHOG-UHFFFAOYSA-N
XLogP-1.64
TPSA121.13 Ų
H-Bond Donors3
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500250.17
LogP ≤ 5-1.64
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2-(2,3-dihydroxypropoxy)-1,1-difluoro-2-oxoethanesulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,3-dihydroxypropoxy)-1,1-difluoro-2-oxoethanesulfonic acid?
The IUPAC name of 2-(2,3-dihydroxypropoxy)-1,1-difluoro-2-oxoethanesulfonic acid (CID 58021584) is 2-(2,3-dihydroxypropoxy)-1,1-difluoro-2-oxoethanesulfonic acid.
What is the SMILES notation for 2-(2,3-dihydroxypropoxy)-1,1-difluoro-2-oxoethanesulfonic acid?
The canonical SMILES for 2-(2,3-dihydroxypropoxy)-1,1-difluoro-2-oxoethanesulfonic acid is O=C(OCC(O)CO)C(F)(F)S(=O)(=O)O.
What is the InChIKey of 2-(2,3-dihydroxypropoxy)-1,1-difluoro-2-oxoethanesulfonic acid?
The InChIKey is MCJYRLMMQBQHOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8F2O7S/c6-5(7,15(11,12)13)4(10)14-2-3(9)1-8/h3,8-9H,1-2H2,(H,11,12,13).
What are the key properties of 2-(2,3-dihydroxypropoxy)-1,1-difluoro-2-oxoethanesulfonic acid?
2-(2,3-dihydroxypropoxy)-1,1-difluoro-2-oxoethanesulfonic acid has a molecular weight of 250.17 g/mol, XLogP of -1.64, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dihydroxypropoxy)-1,1-difluoro-2-oxoethanesulfonic acid is sourced from PubChem (CID 58021584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).