C5H8F2O7S — CID 58021584
2-(2,3-dihydroxypropoxy)-1,1-difluoro-2-oxoethanesulfonic acid (PubChem CID 58021584) has the molecular formula C5H8F2O7S and a molecular weight of 250.17 g/mol. Its IUPAC name is 2-(2,3-dihydroxypropoxy)-1,1-difluoro-2-oxoethanesulfonic acid.
| Compound Name | 2-(2,3-dihydroxypropoxy)-1,1-difluoro-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 58021584 |
| Molecular Formula | C5H8F2O7S |
| Molecular Weight | 250.17 g/mol |
| Exact Mass | 250.00 |
| IUPAC Name | 2-(2,3-dihydroxypropoxy)-1,1-difluoro-2-oxoethanesulfonic acid |
| SMILES | O=C(OCC(O)CO)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C5H8F2O7S/c6-5(7,15(11,12)13)4(10)14-2-3(9)1-8/h3,8-9H,1-2H2,(H,11,12,13) |
| InChIKey | MCJYRLMMQBQHOG-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.17 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|