C29H41F9O9 — CID 91396902
tris[6-(trifluoromethoxy)hexyl] pent-4-yne-1,2,3-tricarboxylate (PubChem CID 91396902) has the molecular formula C29H41F9O9 and a molecular weight of 704.62 g/mol. Its IUPAC name is tris[6-(trifluoromethoxy)hexyl] pent-4-yne-1,2,3-tricarboxylate.
| Compound Name | tris[6-(trifluoromethoxy)hexyl] pent-4-yne-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 91396902 |
| Molecular Formula | C29H41F9O9 |
| Molecular Weight | 704.62 g/mol |
| Exact Mass | 704.26 |
| IUPAC Name | tris[6-(trifluoromethoxy)hexyl] pent-4-yne-1,2,3-tricarboxylate |
| SMILES | C#CC(C(=O)OCCCCCCOC(F)(F)F)C(CC(=O)OCCCCCCOC(F)(F)F)C(=O)OCCCCCCOC(F)(F)F |
| InChI | InChI=1S/C29H41F9O9/c1-2-22(25(40)43-16-10-4-7-13-19-46-28(33,34)35)23(26(41)44-17-11-5-8-14-20-47-29(36,37)38)21-24(39)42-15-9-3-6-12-18-45-27(30,31)32/h1,22-23H,3-21H2 |
| InChIKey | OZKDNDZCLJMSJX-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.62 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|