C58H110O8 — CID 141394509
tetrakis(10-methylundecyl) hexane-1,2,4,5-tetracarboxylate (PubChem CID 141394509) has the molecular formula C58H110O8 and a molecular weight of 935.51 g/mol. Its IUPAC name is tetrakis(10-methylundecyl) hexane-1,2,4,5-tetracarboxylate.
| Compound Name | tetrakis(10-methylundecyl) hexane-1,2,4,5-tetracarboxylate |
|---|---|
| PubChem CID | 141394509 |
| Molecular Formula | C58H110O8 |
| Molecular Weight | 935.51 g/mol |
| Exact Mass | 934.82 |
| IUPAC Name | tetrakis(10-methylundecyl) hexane-1,2,4,5-tetracarboxylate |
| SMILES | CC(C)CCCCCCCCCOC(=O)CC(CC(C(=O)OCCCCCCCCCC(C)C)C(C)C(=O)OCCCCCCCCCC(C)C)C(=O)OCCCCCCCCCC(C)C |
| InChI | InChI=1S/C58H110O8/c1-48(2)38-30-22-14-10-18-26-34-42-63-55(59)47-53(57(61)65-44-36-28-20-12-16-24-32-40-50(5)6)46-54(58(62)66-45-37-29-21-13-17-25-33-41-51(7)8)52(9)56(60)64-43-35-27-19-11-15-23-31-39-49(3)4/h48-54H,10-47H2,1-9H3 |
| InChIKey | WHCUZPRRAVALSY-UHFFFAOYSA-N |
| XLogP | 16.92 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 935.51 |
| LogP ≤ 5 | 16.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|