bis(6-methylheptyl) 2,3-bis(2-ethylbutyl)butanedioate

C32H62O4 — CID 175283951

IUPACbis(6-methylheptyl) 2,3-bis(2-ethylbutyl)butanedioate
SMILESCCC(CC)CC(C(=O)OCCCCCC(C)C)C(CC(CC)CC)C(=O)OCCCCCC(C)C
InChIInChI=1S/C32H62O4/c1-9-27(10-2)23-29(31(33)35-21-17-13-15-19-25(5)6)30(24-28(11-3)12-4)32(34)36-22-18-14-16-20-26(7)8/h25-30H,9-24H2,1-8H3
InChIKeyGDQQBEKGVVQHAG-UHFFFAOYSA-N
MW510.84 g/mol
LogP9.39
Rot. Bonds23

About bis(6-methylheptyl) 2,3-bis(2-ethylbutyl)butanedioate

bis(6-methylheptyl) 2,3-bis(2-ethylbutyl)butanedioate (PubChem CID 175283951) has the molecular formula C32H62O4 and a molecular weight of 510.84 g/mol. Its IUPAC name is bis(6-methylheptyl) 2,3-bis(2-ethylbutyl)butanedioate.

Molecular Properties

Compound Namebis(6-methylheptyl) 2,3-bis(2-ethylbutyl)butanedioate
PubChem CID175283951
Molecular FormulaC32H62O4
Molecular Weight510.84 g/mol
Exact Mass510.46
IUPAC Namebis(6-methylheptyl) 2,3-bis(2-ethylbutyl)butanedioate
SMILESCCC(CC)CC(C(=O)OCCCCCC(C)C)C(CC(CC)CC)C(=O)OCCCCCC(C)C
InChIInChI=1S/C32H62O4/c1-9-27(10-2)23-29(31(33)35-21-17-13-15-19-25(5)6)30(24-28(11-3)12-4)32(34)36-22-18-14-16-20-26(7)8/h25-30H,9-24H2,1-8H3
InChIKeyGDQQBEKGVVQHAG-UHFFFAOYSA-N
XLogP9.39
TPSA52.60 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds23
Heavy Atoms36
Complexity

Lipinski Rule of Five

2 violations

RuleValue
MW ≤ 500510.84
LogP ≤ 59.39
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze bis(6-methylheptyl) 2,3-bis(2-ethylbutyl)butanedioate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of bis(6-methylheptyl) 2,3-bis(2-ethylbutyl)butanedioate?
The IUPAC name of bis(6-methylheptyl) 2,3-bis(2-ethylbutyl)butanedioate (CID 175283951) is bis(6-methylheptyl) 2,3-bis(2-ethylbutyl)butanedioate.
What is the SMILES notation for bis(6-methylheptyl) 2,3-bis(2-ethylbutyl)butanedioate?
The canonical SMILES for bis(6-methylheptyl) 2,3-bis(2-ethylbutyl)butanedioate is CCC(CC)CC(C(=O)OCCCCCC(C)C)C(CC(CC)CC)C(=O)OCCCCCC(C)C.
What is the InChIKey of bis(6-methylheptyl) 2,3-bis(2-ethylbutyl)butanedioate?
The InChIKey is GDQQBEKGVVQHAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H62O4/c1-9-27(10-2)23-29(31(33)35-21-17-13-15-19-25(5)6)30(24-28(11-3)12-4)32(34)36-22-18-14-16-20-26(7)8/h25-30H,9-24H2,1-8H3.
What are the key properties of bis(6-methylheptyl) 2,3-bis(2-ethylbutyl)butanedioate?
bis(6-methylheptyl) 2,3-bis(2-ethylbutyl)butanedioate has a molecular weight of 510.84 g/mol, XLogP of 9.39, 23 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(6-methylheptyl) 2,3-bis(2-ethylbutyl)butanedioate is sourced from PubChem (CID 175283951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).