C32H62O4 — CID 175283951
bis(6-methylheptyl) 2,3-bis(2-ethylbutyl)butanedioate (PubChem CID 175283951) has the molecular formula C32H62O4 and a molecular weight of 510.84 g/mol. Its IUPAC name is bis(6-methylheptyl) 2,3-bis(2-ethylbutyl)butanedioate.
| Compound Name | bis(6-methylheptyl) 2,3-bis(2-ethylbutyl)butanedioate |
|---|---|
| PubChem CID | 175283951 |
| Molecular Formula | C32H62O4 |
| Molecular Weight | 510.84 g/mol |
| Exact Mass | 510.46 |
| IUPAC Name | bis(6-methylheptyl) 2,3-bis(2-ethylbutyl)butanedioate |
| SMILES | CCC(CC)CC(C(=O)OCCCCCC(C)C)C(CC(CC)CC)C(=O)OCCCCCC(C)C |
| InChI | InChI=1S/C32H62O4/c1-9-27(10-2)23-29(31(33)35-21-17-13-15-19-25(5)6)30(24-28(11-3)12-4)32(34)36-22-18-14-16-20-26(7)8/h25-30H,9-24H2,1-8H3 |
| InChIKey | GDQQBEKGVVQHAG-UHFFFAOYSA-N |
| XLogP | 9.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.84 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|