C30H45F9O8 — CID 143923173
bis[6-(trifluoromethoxy)hexyl] (2Z)-2-[(E)-2-[6-(trifluoromethoxy)hexoxy]pent-2-enylidene]butanedioate (PubChem CID 143923173) has the molecular formula C30H45F9O8 and a molecular weight of 704.66 g/mol. Its IUPAC name is bis[6-(trifluoromethoxy)hexyl] (2Z)-2-[(E)-2-[6-(trifluoromethoxy)hexoxy]pent-2-enylidene]butanedioate.
| Compound Name | bis[6-(trifluoromethoxy)hexyl] (2Z)-2-[(E)-2-[6-(trifluoromethoxy)hexoxy]pent-2-enylidene]butanedioate |
|---|---|
| PubChem CID | 143923173 |
| Molecular Formula | C30H45F9O8 |
| Molecular Weight | 704.66 g/mol |
| Exact Mass | 704.30 |
| IUPAC Name | bis[6-(trifluoromethoxy)hexyl] (2Z)-2-[(E)-2-[6-(trifluoromethoxy)hexoxy]pent-2-enylidene]butanedioate |
| SMILES | CC/C=C(\C=C(\CC(=O)OCCCCCCOC(F)(F)F)C(=O)OCCCCCCOC(F)(F)F)OCCCCCCOC(F)(F)F |
| InChI | InChI=1S/C30H45F9O8/c1-2-15-25(42-16-9-3-6-12-19-45-28(31,32)33)22-24(27(41)44-18-11-5-8-14-21-47-30(37,38)39)23-26(40)43-17-10-4-7-13-20-46-29(34,35)36/h15,22H,2-14,16-21,23H2,1H3/b24-22-,25-15+ |
| InChIKey | UZKSMUNTILVALZ-AGDZFYKKSA-N |
| XLogP | 8.99 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.66 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|