C13H17F7O4 — CID 91459836
ethenol;5-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)pentyl prop-2-enoate (PubChem CID 91459836) has the molecular formula C13H17F7O4 and a molecular weight of 370.26 g/mol. Its IUPAC name is ethenol;5-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)pentyl prop-2-enoate.
| Compound Name | ethenol;5-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)pentyl prop-2-enoate |
|---|---|
| PubChem CID | 91459836 |
| Molecular Formula | C13H17F7O4 |
| Molecular Weight | 370.26 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | ethenol;5-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)pentyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCOC(F)(C(F)(F)F)C(F)(F)F.C=CO |
| InChI | InChI=1S/C11H13F7O3.C2H4O/c1-2-8(19)20-6-4-3-5-7-21-9(12,10(13,14)15)11(16,17)18;1-2-3/h2H,1,3-7H2;2-3H,1H2 |
| InChIKey | KRIREFSHILBUSQ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.26 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|