C12H15F9 — CID 87159227
6,6,8,8,10,10-hexafluoro-4-(trifluoromethyl)undec-1-ene (PubChem CID 87159227) has the molecular formula C12H15F9 and a molecular weight of 330.23 g/mol. Its IUPAC name is 6,6,8,8,10,10-hexafluoro-4-(trifluoromethyl)undec-1-ene.
| Compound Name | 6,6,8,8,10,10-hexafluoro-4-(trifluoromethyl)undec-1-ene |
|---|---|
| PubChem CID | 87159227 |
| Molecular Formula | C12H15F9 |
| Molecular Weight | 330.23 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 6,6,8,8,10,10-hexafluoro-4-(trifluoromethyl)undec-1-ene |
| SMILES | C=CCC(CC(F)(F)CC(F)(F)CC(C)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H15F9/c1-3-4-8(12(19,20)21)5-10(15,16)7-11(17,18)6-9(2,13)14/h3,8H,1,4-7H2,2H3 |
| InChIKey | HTHKHLYIBRSSQU-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.23 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|