C13H17BrF9U- — CID 157244986
1-bromo-6,6,8,8,10,10-hexafluoro-2-methanidyl-4-(trifluoromethyl)undecane;uranium (PubChem CID 157244986) has the molecular formula C13H17BrF9U- and a molecular weight of 662.19 g/mol. Its IUPAC name is 1-bromo-6,6,8,8,10,10-hexafluoro-2-methanidyl-4-(trifluoromethyl)undecane;uranium.
| Compound Name | 1-bromo-6,6,8,8,10,10-hexafluoro-2-methanidyl-4-(trifluoromethyl)undecane;uranium |
|---|---|
| PubChem CID | 157244986 |
| Molecular Formula | C13H17BrF9U- |
| Molecular Weight | 662.19 g/mol |
| Exact Mass | 661.09 |
| IUPAC Name | 1-bromo-6,6,8,8,10,10-hexafluoro-2-methanidyl-4-(trifluoromethyl)undecane;uranium |
| SMILES | [CH2-]C(CBr)CC(CC(F)(F)CC(F)(F)CC(C)(F)F)C(F)(F)F.[U] |
| InChI | InChI=1S/C13H17BrF9.U/c1-8(5-14)3-9(13(21,22)23)4-11(17,18)7-12(19,20)6-10(2,15)16;/h8-9H,1,3-7H2,2H3;/q-1; |
| InChIKey | ZCTMZKUNWIMHDS-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.19 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|