C18H17ClF20O2S — CID 59721658
9,9,11,11,13,14,14,14-octafluoro-3,5,7,13-tetrakis(trifluoromethyl)tetradecane-1-sulfonyl chloride (PubChem CID 59721658) has the molecular formula C18H17ClF20O2S and a molecular weight of 712.81 g/mol. Its IUPAC name is 9,9,11,11,13,14,14,14-octafluoro-3,5,7,13-tetrakis(trifluoromethyl)tetradecane-1-sulfonyl chloride.
| Compound Name | 9,9,11,11,13,14,14,14-octafluoro-3,5,7,13-tetrakis(trifluoromethyl)tetradecane-1-sulfonyl chloride |
|---|---|
| PubChem CID | 59721658 |
| Molecular Formula | C18H17ClF20O2S |
| Molecular Weight | 712.81 g/mol |
| Exact Mass | 712.03 |
| IUPAC Name | 9,9,11,11,13,14,14,14-octafluoro-3,5,7,13-tetrakis(trifluoromethyl)tetradecane-1-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)CCC(CC(CC(CC(F)(F)CC(F)(F)CC(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C18H17ClF20O2S/c19-42(40,41)2-1-8(14(25,26)27)3-9(15(28,29)30)4-10(16(31,32)33)5-11(20,21)6-12(22,23)7-13(24,17(34,35)36)18(37,38)39/h8-10H,1-7H2 |
| InChIKey | XQEYRMPWPKJXEC-UHFFFAOYSA-N |
| XLogP | 9.53 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.81 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |